C28H31N9O6 — CID 162666960
3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate (PubChem CID 162666960) has the molecular formula C28H31N9O6 and a molecular weight of 589.61 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 162666960 |
| Molecular Formula | C28H31N9O6 |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
| SMILES | Cn1cc2c(nc(NC(=O)Nc3ccc(CC(=O)OCCCNC(=O)OC(C)(C)C)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C28H31N9O6/c1-28(2,3)43-27(40)29-12-6-14-42-21(38)15-17-8-10-18(11-9-17)30-26(39)33-25-32-22-19(16-36(4)34-22)24-31-23(35-37(24)25)20-7-5-13-41-20/h5,7-11,13,16H,6,12,14-15H2,1-4H3,(H,29,40)(H2,30,32,33,34,39) |
| InChIKey | FYIZJTPWTGJUMN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|