C27H26N2O5 — CID 162667032
4-(2,4-dimethoxyphenyl)-2-phenyl-6-(3,4,5-trimethoxyphenyl)pyrimidine (PubChem CID 162667032) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-2-phenyl-6-(3,4,5-trimethoxyphenyl)pyrimidine.
| Compound Name | 4-(2,4-dimethoxyphenyl)-2-phenyl-6-(3,4,5-trimethoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 162667032 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-2-phenyl-6-(3,4,5-trimethoxyphenyl)pyrimidine |
| SMILES | COc1ccc(-c2cc(-c3cc(OC)c(OC)c(OC)c3)nc(-c3ccccc3)n2)c(OC)c1 |
| InChI | InChI=1S/C27H26N2O5/c1-30-19-11-12-20(23(15-19)31-2)22-16-21(28-27(29-22)17-9-7-6-8-10-17)18-13-24(32-3)26(34-5)25(14-18)33-4/h6-16H,1-5H3 |
| InChIKey | ZMLCTPZDDSWIKM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |