C22H34O6 — CID 162667109
4-[2-[(1R,3S,3aS,7aS)-1-methoxy-4,4,7a-trimethyl-3-propanoyl-3a,5,6,7-tetrahydro-3H-2-benzofuran-1-yl]ethyl]-2-methoxy-2H-furan-5-one (PubChem CID 162667109) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is 4-[2-[(1R,3S,3aS,7aS)-1-methoxy-4,4,7a-trimethyl-3-propanoyl-3a,5,6,7-tetrahydro-3H-2-benzofuran-1-yl]ethyl]-2-methoxy-2H-furan-5-one.
| Compound Name | 4-[2-[(1R,3S,3aS,7aS)-1-methoxy-4,4,7a-trimethyl-3-propanoyl-3a,5,6,7-tetrahydro-3H-2-benzofuran-1-yl]ethyl]-2-methoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 162667109 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 4-[2-[(1R,3S,3aS,7aS)-1-methoxy-4,4,7a-trimethyl-3-propanoyl-3a,5,6,7-tetrahydro-3H-2-benzofuran-1-yl]ethyl]-2-methoxy-2H-furan-5-one |
| SMILES | CCC(=O)[C@H]1O[C@@](CCC2=CC(OC)OC2=O)(OC)[C@@]2(C)CCCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C22H34O6/c1-7-15(23)17-18-20(2,3)10-8-11-21(18,4)22(26-6,28-17)12-9-14-13-16(25-5)27-19(14)24/h13,16-18H,7-12H2,1-6H3/t16?,17-,18+,21+,22-/m1/s1 |
| InChIKey | HGKFGWPPAJKRST-RSKJECSZSA-N |
| XLogP | 3.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |