C23H17BrF6N6O — CID 162667152
N-[(E)-[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-(3-bromoanilino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide (PubChem CID 162667152) has the molecular formula C23H17BrF6N6O and a molecular weight of 587.32 g/mol. Its IUPAC name is N-[(E)-[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-(3-bromoanilino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[(E)-[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-(3-bromoanilino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 162667152 |
| Molecular Formula | C23H17BrF6N6O |
| Molecular Weight | 587.32 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | N-[(E)-[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-(3-bromoanilino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide |
| SMILES | O=C(N/N=C/c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCc2ncnc(Nc3cccc(Br)c3)c2C1 |
| InChI | InChI=1S/C23H17BrF6N6O/c24-16-2-1-3-17(9-16)34-20-18-11-36(5-4-19(18)31-12-32-20)21(37)35-33-10-13-6-14(22(25,26)27)8-15(7-13)23(28,29)30/h1-3,6-10,12H,4-5,11H2,(H,35,37)(H,31,32,34)/b33-10+ |
| InChIKey | VWOWHTLJLIYBBC-AOJZPQQRSA-N |
| XLogP | 6.12 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.32 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|