C21H30O5 — CID 162667242
[(3aR,4S,7S,8aR)-7-methyl-3-methylidene-2-oxo-6-(3-oxobutyl)-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-4-yl] (3R)-3-methylpentanoate (PubChem CID 162667242) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(3aR,4S,7S,8aR)-7-methyl-3-methylidene-2-oxo-6-(3-oxobutyl)-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-4-yl] (3R)-3-methylpentanoate.
| Compound Name | [(3aR,4S,7S,8aR)-7-methyl-3-methylidene-2-oxo-6-(3-oxobutyl)-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-4-yl] (3R)-3-methylpentanoate |
|---|---|
| PubChem CID | 162667242 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(3aR,4S,7S,8aR)-7-methyl-3-methylidene-2-oxo-6-(3-oxobutyl)-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-4-yl] (3R)-3-methylpentanoate |
| SMILES | C=C1C(=O)O[C@@H]2C[C@H](C)C(CCC(C)=O)=C[C@H](OC(=O)C[C@H](C)CC)[C@H]12 |
| InChI | InChI=1S/C21H30O5/c1-6-12(2)9-19(23)25-18-11-16(8-7-14(4)22)13(3)10-17-20(18)15(5)21(24)26-17/h11-13,17-18,20H,5-10H2,1-4H3/t12-,13+,17-,18+,20-/m1/s1 |
| InChIKey | HKLNTXQGMWYTBA-OURCTZAQSA-N |
| XLogP | 3.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|