C19H25NO2 — CID 162667244
(1R,4S,9S,10R,13S,14E)-14-hydroxyimino-9,13-dimethyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-7-en-6-one (PubChem CID 162667244) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (1R,4S,9S,10R,13S,14E)-14-hydroxyimino-9,13-dimethyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-7-en-6-one.
| Compound Name | (1R,4S,9S,10R,13S,14E)-14-hydroxyimino-9,13-dimethyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-7-en-6-one |
|---|---|
| PubChem CID | 162667244 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (1R,4S,9S,10R,13S,14E)-14-hydroxyimino-9,13-dimethyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-7-en-6-one |
| SMILES | C=C1C(=O)C=C[C@]2(C)[C@@H]1CC[C@@]13C/C(=N\O)[C@@](C)(CC[C@H]12)C3 |
| InChI | InChI=1S/C19H25NO2/c1-12-13-4-9-19-10-16(20-22)17(2,11-19)7-6-15(19)18(13,3)8-5-14(12)21/h5,8,13,15,22H,1,4,6-7,9-11H2,2-3H3/b20-16+/t13-,15+,17+,18-,19+/m1/s1 |
| InChIKey | IYGXSTUYXDTCOD-UNLVHCFESA-N |
| XLogP | 4.12 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|