C20H22ClNO6 — CID 162667268
(3S,4R)-3-(chloromethyl)-4-(3-hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one (PubChem CID 162667268) has the molecular formula C20H22ClNO6 and a molecular weight of 407.85 g/mol. Its IUPAC name is (3S,4R)-3-(chloromethyl)-4-(3-hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one.
| Compound Name | (3S,4R)-3-(chloromethyl)-4-(3-hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 162667268 |
| Molecular Formula | C20H22ClNO6 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (3S,4R)-3-(chloromethyl)-4-(3-hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
| SMILES | COc1ccc([C@H]2[C@H](CCl)C(=O)N2c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C20H22ClNO6/c1-25-15-6-5-11(7-14(15)23)18-13(10-21)20(24)22(18)12-8-16(26-2)19(28-4)17(9-12)27-3/h5-9,13,18,23H,10H2,1-4H3/t13-,18-/m0/s1 |
| InChIKey | KSDWMPSZBFEYCC-UGSOOPFHSA-N |
| XLogP | 3.37 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|