C17H23NO6 — CID 162667275
(4S)-1-benzyl-4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypyrrolidin-2-one (PubChem CID 162667275) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is (4S)-1-benzyl-4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypyrrolidin-2-one.
| Compound Name | (4S)-1-benzyl-4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypyrrolidin-2-one |
|---|---|
| PubChem CID | 162667275 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (4S)-1-benzyl-4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypyrrolidin-2-one |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2CC(=O)N(Cc3ccccc3)C2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H23NO6/c1-10-14(20)15(21)16(22)17(23-10)24-12-7-13(19)18(9-12)8-11-5-3-2-4-6-11/h2-6,10,12,14-17,20-22H,7-9H2,1H3/t10-,12-,14-,15+,16+,17-/m0/s1 |
| InChIKey | PUFFTZHADISSRO-JYKFYOGASA-N |
| XLogP | -0.37 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |