C19H23ClN5O8PS — CID 162667677
[(2S,3S,4R,5R)-5-[2-chloro-6-[[(1R)-1-phenylethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 162667677) has the molecular formula C19H23ClN5O8PS and a molecular weight of 547.91 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[2-chloro-6-[[(1R)-1-phenylethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[2-chloro-6-[[(1R)-1-phenylethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 162667677 |
| Molecular Formula | C19H23ClN5O8PS |
| Molecular Weight | 547.91 g/mol |
| Exact Mass | 547.07 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[2-chloro-6-[[(1R)-1-phenylethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | C[C@@H](Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](CS(=O)(=O)CP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C19H23ClN5O8PS/c1-10(11-5-3-2-4-6-11)22-16-13-17(24-19(20)23-16)25(8-21-13)18-15(27)14(26)12(33-18)7-35(31,32)9-34(28,29)30/h2-6,8,10,12,14-15,18,26-27H,7,9H2,1H3,(H,22,23,24)(H2,28,29,30)/t10-,12-,14-,15-,18-/m1/s1 |
| InChIKey | SOPDPVJBRHSSHX-DPHITLOKSA-N |
| XLogP | 0.82 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.91 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|