C11H9F3N8 — CID 162668060
2-N-pyrimidin-2-yl-6-N-(2,2,2-trifluoroethyl)-7H-purine-2,6-diamine (PubChem CID 162668060) has the molecular formula C11H9F3N8 and a molecular weight of 310.24 g/mol. Its IUPAC name is 2-N-pyrimidin-2-yl-6-N-(2,2,2-trifluoroethyl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-pyrimidin-2-yl-6-N-(2,2,2-trifluoroethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 162668060 |
| Molecular Formula | C11H9F3N8 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-N-pyrimidin-2-yl-6-N-(2,2,2-trifluoroethyl)-7H-purine-2,6-diamine |
| SMILES | FC(F)(F)CNc1nc(Nc2ncccn2)nc2nc[nH]c12 |
| InChI | InChI=1S/C11H9F3N8/c12-11(13,14)4-17-7-6-8(19-5-18-6)21-10(20-7)22-9-15-2-1-3-16-9/h1-3,5H,4H2,(H3,15,16,17,18,19,20,21,22) |
| InChIKey | USWPYHFFAGSQOD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |