About [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate
[1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate (PubChem CID 162668159) has the molecular formula C25H32N2O2
and a molecular weight of 392.54 g/mol. Its IUPAC name is [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate.
Molecular Properties
| Compound Name | [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate |
| PubChem CID | 162668159 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate |
| SMILES | CC(C)c1ccc(NC(=O)OCC2CCCN(C3Cc4ccccc4C3)C2)cc1 |
| InChI | InChI=1S/C25H32N2O2/c1-18(2)20-9-11-23(12-10-20)26-25(28)29-17-19-6-5-13-27(16-19)24-14-21-7-3-4-8-22(21)15-24/h3-4,7-12,18-19,24H,5-6,13-17H2,1-2H3,(H,26,28) |
| InChIKey | UOOJEAOFHZRSSH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate?
The IUPAC name of [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate (CID 162668159) is [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate.
What is the SMILES notation for [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate?
The canonical SMILES for [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate is CC(C)c1ccc(NC(=O)OCC2CCCN(C3Cc4ccccc4C3)C2)cc1.
What is the InChIKey of [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate?
The InChIKey is UOOJEAOFHZRSSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32N2O2/c1-18(2)20-9-11-23(12-10-20)26-25(28)29-17-19-6-5-13-27(16-19)24-14-21-7-3-4-8-22(21)15-24/h3-4,7-12,18-19,24H,5-6,13-17H2,1-2H3,(H,26,28).
What are the key properties of [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate?
[1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate has a molecular weight of 392.54 g/mol, XLogP of 5.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl N-(4-propan-2-ylphenyl)carbamate is sourced from PubChem (CID 162668159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).