C25H26N6O5 — CID 162668193
2-(3,6-dimethyl-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 162668193) has the molecular formula C25H26N6O5 and a molecular weight of 490.52 g/mol. Its IUPAC name is 2-(3,6-dimethyl-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(3,6-dimethyl-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 162668193 |
| Molecular Formula | C25H26N6O5 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 2-(3,6-dimethyl-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)COc2nc(C)nc3c2c(C)nn3-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H26N6O5/c1-15-22-24(31(30-15)18-9-7-6-8-10-18)27-16(2)28-25(22)36-14-21(32)29-26-13-17-11-19(33-3)23(35-5)20(12-17)34-4/h6-13H,14H2,1-5H3,(H,29,32)/b26-13+ |
| InChIKey | SCJAFDTZIMGDML-LGJNPRDNSA-N |
| XLogP | 2.99 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|