C24H17F6N7O5 — CID 162668277
1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-N-[(E)-(3,4-dimethoxy-2-nitrophenyl)methylideneamino]-5-methyltriazole-4-carboxamide (PubChem CID 162668277) has the molecular formula C24H17F6N7O5 and a molecular weight of 597.43 g/mol. Its IUPAC name is 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-N-[(E)-(3,4-dimethoxy-2-nitrophenyl)methylideneamino]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-N-[(E)-(3,4-dimethoxy-2-nitrophenyl)methylideneamino]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 162668277 |
| Molecular Formula | C24H17F6N7O5 |
| Molecular Weight | 597.43 g/mol |
| Exact Mass | 597.12 |
| IUPAC Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-N-[(E)-(3,4-dimethoxy-2-nitrophenyl)methylideneamino]-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2nnn(-c3cc(C(F)(F)F)nc4c(C(F)(F)F)cccc34)c2C)c([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C24H17F6N7O5/c1-11-18(22(38)34-31-10-12-7-8-16(41-2)21(42-3)20(12)37(39)40)33-35-36(11)15-9-17(24(28,29)30)32-19-13(15)5-4-6-14(19)23(25,26)27/h4-10H,1-3H3,(H,34,38)/b31-10+ |
| InChIKey | XXSMZOCMWXYSFK-VNTWQREPSA-N |
| XLogP | 4.85 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|