C22H18F6N6O — CID 162668321
(12Z)-18-(trifluoromethyl)-5-[6-(trifluoromethyl)-2-pyridinyl]-15-oxa-2,4,6,8,21-pentazatricyclo[14.3.1.13,7]henicosa-1(20),3,5,7(21),12,16,18-heptaene (PubChem CID 162668321) has the molecular formula C22H18F6N6O and a molecular weight of 496.42 g/mol. Its IUPAC name is (12Z)-18-(trifluoromethyl)-5-[6-(trifluoromethyl)-2-pyridinyl]-15-oxa-2,4,6,8,21-pentazatricyclo[14.3.1.13,7]henicosa-1(20),3,5,7(21),12,16,18-heptaene.
| Compound Name | (12Z)-18-(trifluoromethyl)-5-[6-(trifluoromethyl)-2-pyridinyl]-15-oxa-2,4,6,8,21-pentazatricyclo[14.3.1.13,7]henicosa-1(20),3,5,7(21),12,16,18-heptaene |
|---|---|
| PubChem CID | 162668321 |
| Molecular Formula | C22H18F6N6O |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | (12Z)-18-(trifluoromethyl)-5-[6-(trifluoromethyl)-2-pyridinyl]-15-oxa-2,4,6,8,21-pentazatricyclo[14.3.1.13,7]henicosa-1(20),3,5,7(21),12,16,18-heptaene |
| SMILES | FC(F)(F)c1cc2cc(c1)OC/C=C\CCCNc1nc(nc(-c3cccc(C(F)(F)F)n3)n1)N2 |
| InChI | InChI=1S/C22H18F6N6O/c23-21(24,25)13-10-14-12-15(11-13)35-9-4-2-1-3-8-29-19-32-18(33-20(30-14)34-19)16-6-5-7-17(31-16)22(26,27)28/h2,4-7,10-12H,1,3,8-9H2,(H2,29,30,32,33,34)/b4-2- |
| InChIKey | FAMLELDKQOPNEV-RQOWECAXSA-N |
| XLogP | 5.86 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|