C34H32F3NO3 — CID 162668378
(3S)-3-[4-[[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 162668378) has the molecular formula C34H32F3NO3 and a molecular weight of 559.63 g/mol. Its IUPAC name is (3S)-3-[4-[[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 162668378 |
| Molecular Formula | C34H32F3NO3 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | (3S)-3-[4-[[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc(CN3CCC4(C=Cc5ccccc54)CC3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C34H32F3NO3/c1-2-5-27(21-32(39)40)25-10-12-29(13-11-25)41-23-24-8-9-28(31(20-24)34(35,36)37)22-38-18-16-33(17-19-38)15-14-26-6-3-4-7-30(26)33/h3-4,6-15,20,27H,16-19,21-23H2,1H3,(H,39,40)/t27-/m0/s1 |
| InChIKey | ZFECBEZYHLZTCS-MHZLTWQESA-N |
| XLogP | 7.43 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|