About butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate
butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate (PubChem CID 162668504) has the molecular formula C21H25NO4S
and a molecular weight of 387.50 g/mol. Its IUPAC name is butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate.
Molecular Properties
| Compound Name | butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate |
| PubChem CID | 162668504 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate |
| SMILES | CCCCOC(=O)CC1c2cccc(C)c2S(=O)(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO4S/c1-3-4-13-26-20(23)14-19-18-12-8-9-16(2)21(18)27(24,25)22(19)15-17-10-6-5-7-11-17/h5-12,19H,3-4,13-15H2,1-2H3 |
| InChIKey | ZMERSFMRTYXBSY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate?
The IUPAC name of butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate (CID 162668504) is butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate.
What is the SMILES notation for butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate?
The canonical SMILES for butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate is CCCCOC(=O)CC1c2cccc(C)c2S(=O)(=O)N1Cc1ccccc1.
What is the InChIKey of butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate?
The InChIKey is ZMERSFMRTYXBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO4S/c1-3-4-13-26-20(23)14-19-18-12-8-9-16(2)21(18)27(24,25)22(19)15-17-10-6-5-7-11-17/h5-12,19H,3-4,13-15H2,1-2H3.
What are the key properties of butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate?
butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate has a molecular weight of 387.50 g/mol, XLogP of 3.97, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-(2-benzyl-7-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)acetate is sourced from PubChem (CID 162668504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).