C27H28F3N3O3 — CID 162668513
6-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[[3-(trifluoromethyl)phenyl]methyl]indol-1-yl]-N-hydroxyhexanamide (PubChem CID 162668513) has the molecular formula C27H28F3N3O3 and a molecular weight of 499.53 g/mol. Its IUPAC name is 6-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[[3-(trifluoromethyl)phenyl]methyl]indol-1-yl]-N-hydroxyhexanamide.
| Compound Name | 6-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[[3-(trifluoromethyl)phenyl]methyl]indol-1-yl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 162668513 |
| Molecular Formula | C27H28F3N3O3 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 6-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[[3-(trifluoromethyl)phenyl]methyl]indol-1-yl]-N-hydroxyhexanamide |
| SMILES | Cc1noc(C)c1-c1ccc2c(c1)c(Cc1cccc(C(F)(F)F)c1)cn2CCCCCC(=O)NO |
| InChI | InChI=1S/C27H28F3N3O3/c1-17-26(18(2)36-32-17)20-10-11-24-23(15-20)21(13-19-7-6-8-22(14-19)27(28,29)30)16-33(24)12-5-3-4-9-25(34)31-35/h6-8,10-11,14-16,35H,3-5,9,12-13H2,1-2H3,(H,31,34) |
| InChIKey | SMIZIRYSABRXPT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|