C25H28N4O4 — CID 162668565
N-[2-[[3-(3,5-dimethoxybenzoyl)-1H-pyrrolo[2,3-b]pyridin-6-yl]amino]cyclohexyl]prop-2-enamide (PubChem CID 162668565) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[2-[[3-(3,5-dimethoxybenzoyl)-1H-pyrrolo[2,3-b]pyridin-6-yl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | N-[2-[[3-(3,5-dimethoxybenzoyl)-1H-pyrrolo[2,3-b]pyridin-6-yl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 162668565 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[2-[[3-(3,5-dimethoxybenzoyl)-1H-pyrrolo[2,3-b]pyridin-6-yl]amino]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCCCC1Nc1ccc2c(C(=O)c3cc(OC)cc(OC)c3)c[nH]c2n1 |
| InChI | InChI=1S/C25H28N4O4/c1-4-23(30)28-21-8-6-5-7-20(21)27-22-10-9-18-19(14-26-25(18)29-22)24(31)15-11-16(32-2)13-17(12-15)33-3/h4,9-14,20-21H,1,5-8H2,2-3H3,(H,28,30)(H2,26,27,29) |
| InChIKey | RNWADKFDCRHTAR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|