C16H18N4O3 — CID 162668655
(1S,2R,3R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)-3-methyl-4-methylidenecyclopentane-1,2-diol (PubChem CID 162668655) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is (1S,2R,3R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)-3-methyl-4-methylidenecyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)-3-methyl-4-methylidenecyclopentane-1,2-diol |
|---|---|
| PubChem CID | 162668655 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (1S,2R,3R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)-3-methyl-4-methylidenecyclopentane-1,2-diol |
| SMILES | C#Cc1cn([C@@H]2C(=C)[C@](C)(CO)[C@@H](O)[C@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C16H18N4O3/c1-4-9-5-20(15-10(9)14(17)18-7-19-15)11-8(2)16(3,6-21)13(23)12(11)22/h1,5,7,11-13,21-23H,2,6H2,3H3,(H2,17,18,19)/t11-,12+,13+,16+/m1/s1 |
| InChIKey | GKFLXSICVZAFGO-DVZHBHJUSA-N |
| XLogP | -0.17 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|