About 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol
2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol (PubChem CID 162668717) has the molecular formula C15H13BrO3
and a molecular weight of 321.17 g/mol. Its IUPAC name is 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol.
Molecular Properties
| Compound Name | 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol |
| PubChem CID | 162668717 |
| Molecular Formula | C15H13BrO3 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol |
| SMILES | OC[C@H]1c2ccccc2O[C@@H]1c1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C15H13BrO3/c16-12-7-9(5-6-13(12)18)15-11(8-17)10-3-1-2-4-14(10)19-15/h1-7,11,15,17-18H,8H2/t11-,15+/m0/s1 |
| InChIKey | YEWOPSJIGIYQCG-XHDPSFHLSA-N |
| XLogP | 3.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol?
The IUPAC name of 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol (CID 162668717) is 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol.
What is the SMILES notation for 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol?
The canonical SMILES for 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol is OC[C@H]1c2ccccc2O[C@@H]1c1ccc(O)c(Br)c1.
What is the InChIKey of 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol?
The InChIKey is YEWOPSJIGIYQCG-XHDPSFHLSA-N. The full InChI is InChI=1S/C15H13BrO3/c16-12-7-9(5-6-13(12)18)15-11(8-17)10-3-1-2-4-14(10)19-15/h1-7,11,15,17-18H,8H2/t11-,15+/m0/s1.
What are the key properties of 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol?
2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol has a molecular weight of 321.17 g/mol, XLogP of 3.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-[(2S,3R)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-2-yl]phenol is sourced from PubChem (CID 162668717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).