C25H27N7O3 — CID 162668829
ethyl 7-acetyl-8-methyl-12-(4-piperazin-1-ylanilino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-4-carboxylate (PubChem CID 162668829) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is ethyl 7-acetyl-8-methyl-12-(4-piperazin-1-ylanilino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-4-carboxylate.
| Compound Name | ethyl 7-acetyl-8-methyl-12-(4-piperazin-1-ylanilino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 162668829 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | ethyl 7-acetyl-8-methyl-12-(4-piperazin-1-ylanilino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-4-carboxylate |
| SMILES | CCOC(=O)c1cn2c(n1)c(C(C)=O)c(C)c1cnc(Nc3ccc(N4CCNCC4)cc3)nc12 |
| InChI | InChI=1S/C25H27N7O3/c1-4-35-24(34)20-14-32-22-19(15(2)21(16(3)33)23(32)29-20)13-27-25(30-22)28-17-5-7-18(8-6-17)31-11-9-26-10-12-31/h5-8,13-14,26H,4,9-12H2,1-3H3,(H,27,28,30) |
| InChIKey | RWVHATYIGCOGDP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|