C22H33N — CID 162669076
(1S,2S,5S,8S)-N-benzyl-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecan-2-amine (PubChem CID 162669076) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is (1S,2S,5S,8S)-N-benzyl-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecan-2-amine.
| Compound Name | (1S,2S,5S,8S)-N-benzyl-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecan-2-amine |
|---|---|
| PubChem CID | 162669076 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | (1S,2S,5S,8S)-N-benzyl-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecan-2-amine |
| SMILES | CC1(C)C[C@H](NCc2ccccc2)[C@]23CCC[C@@](C)(CC[C@@H]12)C3 |
| InChI | InChI=1S/C22H33N/c1-20(2)14-19(23-15-17-8-5-4-6-9-17)22-12-7-11-21(3,16-22)13-10-18(20)22/h4-6,8-9,18-19,23H,7,10-16H2,1-3H3/t18-,19-,21-,22-/m0/s1 |
| InChIKey | PNWUWTWLYCGBSL-LGGPRVQUSA-N |
| XLogP | 5.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |