C27H31N3 — CID 162669080
N-[[(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaen-17-yl]methyl]-1-phenylmethanamine (PubChem CID 162669080) has the molecular formula C27H31N3 and a molecular weight of 397.57 g/mol. Its IUPAC name is N-[[(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaen-17-yl]methyl]-1-phenylmethanamine.
| Compound Name | N-[[(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaen-17-yl]methyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 162669080 |
| Molecular Formula | C27H31N3 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-[[(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaen-17-yl]methyl]-1-phenylmethanamine |
| SMILES | CC[C@@]12C=C(CNCc3ccccc3)n3c4c(c5ccccc53)CCN(CCC1)[C@H]42 |
| InChI | InChI=1S/C27H31N3/c1-2-27-14-8-15-29-16-13-23-22-11-6-7-12-24(22)30(25(23)26(27)29)21(17-27)19-28-18-20-9-4-3-5-10-20/h3-7,9-12,17,26,28H,2,8,13-16,18-19H2,1H3/t26-,27+/m1/s1 |
| InChIKey | OQXHWXLECQGZPO-SXOMAYOGSA-N |
| XLogP | 5.38 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |