C21H30O5 — CID 162669083
4-[2-[(4aR,6R,8aS)-6-hydroxy-2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]ethyl]-2-methoxy-2H-furan-5-one (PubChem CID 162669083) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 4-[2-[(4aR,6R,8aS)-6-hydroxy-2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]ethyl]-2-methoxy-2H-furan-5-one.
| Compound Name | 4-[2-[(4aR,6R,8aS)-6-hydroxy-2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]ethyl]-2-methoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 162669083 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 4-[2-[(4aR,6R,8aS)-6-hydroxy-2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]ethyl]-2-methoxy-2H-furan-5-one |
| SMILES | COC1C=C(CCC2=C(C)C(=O)C[C@H]3C(C)(C)[C@H](O)CC[C@]23C)C(=O)O1 |
| InChI | InChI=1S/C21H30O5/c1-12-14(7-6-13-10-18(25-5)26-19(13)24)21(4)9-8-17(23)20(2,3)16(21)11-15(12)22/h10,16-18,23H,6-9,11H2,1-5H3/t16-,17+,18?,21+/m0/s1 |
| InChIKey | NEJLYDMEHOBZMN-VESXYSOKSA-N |
| XLogP | 3.32 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |