About 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione
3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione (PubChem CID 162669125) has the molecular formula C22H17ClN2S
and a molecular weight of 376.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione |
| PubChem CID | 162669125 |
| Molecular Formula | C22H17ClN2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione |
| SMILES | S=C1N=C(c2ccccc2)CC(c2ccccc2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H17ClN2S/c23-18-11-13-19(14-12-18)25-21(17-9-5-2-6-10-17)15-20(24-22(25)26)16-7-3-1-4-8-16/h1-14,21H,15H2 |
| InChIKey | DYOIXZILDRZUNP-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione?
The IUPAC name of 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione (CID 162669125) is 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione.
What is the SMILES notation for 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione?
The canonical SMILES for 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione is S=C1N=C(c2ccccc2)CC(c2ccccc2)N1c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione?
The InChIKey is DYOIXZILDRZUNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17ClN2S/c23-18-11-13-19(14-12-18)25-21(17-9-5-2-6-10-17)15-20(24-22(25)26)16-7-3-1-4-8-16/h1-14,21H,15H2.
What are the key properties of 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione?
3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione has a molecular weight of 376.91 g/mol, XLogP of 6.07, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-4,6-diphenyl-4,5-dihydropyrimidine-2-thione is sourced from PubChem (CID 162669125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).