C18H22BrF3N2O2 — CID 162669345
2-[6-bromo-1-(3-methylbut-2-enyl)indol-3-yl]-N-methylethanamine;2,2,2-trifluoroacetic acid (PubChem CID 162669345) has the molecular formula C18H22BrF3N2O2 and a molecular weight of 435.28 g/mol. Its IUPAC name is 2-[6-bromo-1-(3-methylbut-2-enyl)indol-3-yl]-N-methylethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[6-bromo-1-(3-methylbut-2-enyl)indol-3-yl]-N-methylethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162669345 |
| Molecular Formula | C18H22BrF3N2O2 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-[6-bromo-1-(3-methylbut-2-enyl)indol-3-yl]-N-methylethanamine;2,2,2-trifluoroacetic acid |
| SMILES | CNCCc1cn(CC=C(C)C)c2cc(Br)ccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21BrN2.C2HF3O2/c1-12(2)7-9-19-11-13(6-8-18-3)15-5-4-14(17)10-16(15)19;3-2(4,5)1(6)7/h4-5,7,10-11,18H,6,8-9H2,1-3H3;(H,6,7) |
| InChIKey | ASVBUUIBUNQLHM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|