C38H52 — CID 162669491
1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2-methylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene (PubChem CID 162669491) has the molecular formula C38H52 and a molecular weight of 508.83 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2-methylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2-methylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene |
|---|---|
| PubChem CID | 162669491 |
| Molecular Formula | C38H52 |
| Molecular Weight | 508.83 g/mol |
| Exact Mass | 508.41 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2-methylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)CCCC1 |
| InChI | InChI=1S/C38H52/c1-30(18-13-20-32(3)25-27-36-24-12-11-22-34(36)5)16-9-10-17-31(2)19-14-21-33(4)26-28-37-35(6)23-15-29-38(37,7)8/h9-10,13-14,16-21,25-28H,11-12,15,22-24,29H2,1-8H3/b10-9+,18-13+,19-14+,27-25+,28-26+,30-16+,31-17+,32-20+,33-21+ |
| InChIKey | OJKVNSOZHYKLQR-WSRSPSKNSA-N |
| XLogP | 11.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.83 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|