C19H21F2N5 — CID 162669622
2-(1,1-difluoroethyl)-N-(4,7-dimethyl-2,3-dihydro-1H-inden-2-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 162669622) has the molecular formula C19H21F2N5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-N-(4,7-dimethyl-2,3-dihydro-1H-inden-2-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 2-(1,1-difluoroethyl)-N-(4,7-dimethyl-2,3-dihydro-1H-inden-2-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 162669622 |
| Molecular Formula | C19H21F2N5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 2-(1,1-difluoroethyl)-N-(4,7-dimethyl-2,3-dihydro-1H-inden-2-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(NC2Cc3c(C)ccc(C)c3C2)n2nc(C(C)(F)F)nc2n1 |
| InChI | InChI=1S/C19H21F2N5/c1-10-5-6-11(2)15-9-13(8-14(10)15)23-16-7-12(3)22-18-24-17(19(4,20)21)25-26(16)18/h5-7,13,23H,8-9H2,1-4H3 |
| InChIKey | SSKKUEPOXJAQCQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |