C24H17F3O6 — CID 162669873
dimethyl 5,8-dioxo-6-[4-(trifluoromethyl)phenyl]-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate (PubChem CID 162669873) has the molecular formula C24H17F3O6 and a molecular weight of 458.39 g/mol. Its IUPAC name is dimethyl 5,8-dioxo-6-[4-(trifluoromethyl)phenyl]-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate.
| Compound Name | dimethyl 5,8-dioxo-6-[4-(trifluoromethyl)phenyl]-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 162669873 |
| Molecular Formula | C24H17F3O6 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | dimethyl 5,8-dioxo-6-[4-(trifluoromethyl)phenyl]-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc3c(cc2C1)C(=O)C(c1ccc(C(F)(F)F)cc1)=CC3=O |
| InChI | InChI=1S/C24H17F3O6/c1-32-21(30)23(22(31)33-2)10-13-7-17-18(8-14(13)11-23)20(29)16(9-19(17)28)12-3-5-15(6-4-12)24(25,26)27/h3-9H,10-11H2,1-2H3 |
| InChIKey | KAEBPPHECQJVSR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|