About 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline
4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline (PubChem CID 162670153) has the molecular formula C30H32N2O4
and a molecular weight of 484.60 g/mol. Its IUPAC name is 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline.
Molecular Properties
| Compound Name | 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline |
| PubChem CID | 162670153 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline |
| SMILES | COc1ccc(CCNCc2c(OC)ccc(Oc3ccc(Nc4ccccc4)cc3)c2OC)cc1 |
| InChI | InChI=1S/C30H32N2O4/c1-33-25-13-9-22(10-14-25)19-20-31-21-27-28(34-2)17-18-29(30(27)35-3)36-26-15-11-24(12-16-26)32-23-7-5-4-6-8-23/h4-18,31-32H,19-21H2,1-3H3 |
| InChIKey | QNFSUYNGCAVGMA-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline?
The IUPAC name of 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline (CID 162670153) is 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline.
What is the SMILES notation for 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline?
The canonical SMILES for 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline is COc1ccc(CCNCc2c(OC)ccc(Oc3ccc(Nc4ccccc4)cc3)c2OC)cc1.
What is the InChIKey of 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline?
The InChIKey is QNFSUYNGCAVGMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32N2O4/c1-33-25-13-9-22(10-14-25)19-20-31-21-27-28(34-2)17-18-29(30(27)35-3)36-26-15-11-24(12-16-26)32-23-7-5-4-6-8-23/h4-18,31-32H,19-21H2,1-3H3.
What are the key properties of 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline?
4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline has a molecular weight of 484.60 g/mol, XLogP of 6.58, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,4-dimethoxy-3-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline is sourced from PubChem (CID 162670153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).