C17H16N6O4 — CID 162670156
(2S)-2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]-4-phenylbutanoic acid (PubChem CID 162670156) has the molecular formula C17H16N6O4 and a molecular weight of 368.35 g/mol. Its IUPAC name is (2S)-2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]-4-phenylbutanoic acid.
| Compound Name | (2S)-2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 162670156 |
| Molecular Formula | C17H16N6O4 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (2S)-2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]-4-phenylbutanoic acid |
| SMILES | Nc1nc2nc(C(=O)N[C@@H](CCc3ccccc3)C(=O)O)cnc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H16N6O4/c18-17-22-13-12(15(25)23-17)19-8-11(20-13)14(24)21-10(16(26)27)7-6-9-4-2-1-3-5-9/h1-5,8,10H,6-7H2,(H,21,24)(H,26,27)(H3,18,20,22,23,25)/t10-/m0/s1 |
| InChIKey | CHPGDIWMRACXGP-JTQLQIEISA-N |
| XLogP | 0.11 |
| TPSA | 163.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |