C23H23N7OS — CID 162670310
N-[2-(dimethylamino)-5-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]pyridine-4-carboxamide (PubChem CID 162670310) has the molecular formula C23H23N7OS and a molecular weight of 445.55 g/mol. Its IUPAC name is N-[2-(dimethylamino)-5-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]pyridine-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)-5-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 162670310 |
| Molecular Formula | C23H23N7OS |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[2-(dimethylamino)-5-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]pyridine-4-carboxamide |
| SMILES | CN(C)c1ccc(Nc2ncnc3sc4c(c23)CCNC4)cc1NC(=O)c1ccncc1 |
| InChI | InChI=1S/C23H23N7OS/c1-30(2)18-4-3-15(11-17(18)29-22(31)14-5-8-24-9-6-14)28-21-20-16-7-10-25-12-19(16)32-23(20)27-13-26-21/h3-6,8-9,11,13,25H,7,10,12H2,1-2H3,(H,29,31)(H,26,27,28) |
| InChIKey | HORDWGXYIMFVOR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|