C25H22N2O5 — CID 162670564
4-[2-phenyl-6-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]benzene-1,3-diol (PubChem CID 162670564) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 4-[2-phenyl-6-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]benzene-1,3-diol.
| Compound Name | 4-[2-phenyl-6-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 162670564 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 4-[2-phenyl-6-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]benzene-1,3-diol |
| SMILES | COc1cc(-c2cc(-c3ccc(O)cc3O)nc(-c3ccccc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C25H22N2O5/c1-30-22-11-16(12-23(31-2)24(22)32-3)19-14-20(18-10-9-17(28)13-21(18)29)27-25(26-19)15-7-5-4-6-8-15/h4-14,28-29H,1-3H3 |
| InChIKey | SAEDGNQHIAFYSY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |