C28H25N7O3S — CID 162670603
N-[2-(dimethylamino)-5-[[11-(pyridine-2-carbonyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]phenyl]furan-2-carboxamide (PubChem CID 162670603) has the molecular formula C28H25N7O3S and a molecular weight of 539.62 g/mol. Its IUPAC name is N-[2-(dimethylamino)-5-[[11-(pyridine-2-carbonyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-(dimethylamino)-5-[[11-(pyridine-2-carbonyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 162670603 |
| Molecular Formula | C28H25N7O3S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | N-[2-(dimethylamino)-5-[[11-(pyridine-2-carbonyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]phenyl]furan-2-carboxamide |
| SMILES | CN(C)c1ccc(Nc2ncnc3sc4c(c23)CCN(C(=O)c2ccccn2)C4)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C28H25N7O3S/c1-34(2)21-9-8-17(14-20(21)33-26(36)22-7-5-13-38-22)32-25-24-18-10-12-35(28(37)19-6-3-4-11-29-19)15-23(18)39-27(24)31-16-30-25/h3-9,11,13-14,16H,10,12,15H2,1-2H3,(H,33,36)(H,30,31,32) |
| InChIKey | DSQAQUMQWFLMHF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|