C22H28O5 — CID 162670659
[(4aR,5S,10aR,11aS,11bS)-4,4,8,11b-tetramethyl-7,9-dioxo-1,2,3,4a,5,10a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] acetate (PubChem CID 162670659) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is [(4aR,5S,10aR,11aS,11bS)-4,4,8,11b-tetramethyl-7,9-dioxo-1,2,3,4a,5,10a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] acetate.
| Compound Name | [(4aR,5S,10aR,11aS,11bS)-4,4,8,11b-tetramethyl-7,9-dioxo-1,2,3,4a,5,10a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] acetate |
|---|---|
| PubChem CID | 162670659 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | [(4aR,5S,10aR,11aS,11bS)-4,4,8,11b-tetramethyl-7,9-dioxo-1,2,3,4a,5,10a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C2C(=O)C3=C(C)C(=O)O[C@@H]3C[C@H]2[C@]2(C)CCCC(C)(C)[C@@H]12 |
| InChI | InChI=1S/C22H28O5/c1-11-17-15(27-20(11)25)10-14-13(18(17)24)9-16(26-12(2)23)19-21(3,4)7-6-8-22(14,19)5/h9,14-16,19H,6-8,10H2,1-5H3/t14-,15-,16+,19-,22+/m1/s1 |
| InChIKey | LNCQYZIVXXGWLI-PZJWQNMWSA-N |
| XLogP | 3.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |