About 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine
2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine (PubChem CID 162670681) has the molecular formula C16H16Cl2N6
and a molecular weight of 363.25 g/mol. Its IUPAC name is 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 162670681 |
| Molecular Formula | C16H16Cl2N6 |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1cnc2nc(N3CCN(c4cnc(Cl)c(Cl)c4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C16H16Cl2N6/c1-10-6-13-15(20-8-10)22-16(21-13)24-4-2-23(3-5-24)11-7-12(17)14(18)19-9-11/h6-9H,2-5H2,1H3,(H,20,21,22) |
| InChIKey | FQHMPHHYHOYHLY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine (CID 162670681) is 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine is Cc1cnc2nc(N3CCN(c4cnc(Cl)c(Cl)c4)CC3)[nH]c2c1.
What is the InChIKey of 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine?
The InChIKey is FQHMPHHYHOYHLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2N6/c1-10-6-13-15(20-8-10)22-16(21-13)24-4-2-23(3-5-24)11-7-12(17)14(18)19-9-11/h6-9H,2-5H2,1H3,(H,20,21,22).
What are the key properties of 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine?
2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine has a molecular weight of 363.25 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5,6-dichloro-3-pyridinyl)piperazin-1-yl]-6-methyl-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 162670681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).