C23H24ClF2N3O — CID 162670826
1'-[(3-chloro-2,6-difluorophenyl)methyl]-6-methoxyspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine] (PubChem CID 162670826) has the molecular formula C23H24ClF2N3O and a molecular weight of 431.91 g/mol. Its IUPAC name is 1'-[(3-chloro-2,6-difluorophenyl)methyl]-6-methoxyspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine].
| Compound Name | 1'-[(3-chloro-2,6-difluorophenyl)methyl]-6-methoxyspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine] |
|---|---|
| PubChem CID | 162670826 |
| Molecular Formula | C23H24ClF2N3O |
| Molecular Weight | 431.91 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1'-[(3-chloro-2,6-difluorophenyl)methyl]-6-methoxyspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine] |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCNC31CCN(Cc2c(F)ccc(Cl)c2F)CC1 |
| InChI | InChI=1S/C23H24ClF2N3O/c1-30-14-2-5-20-16(12-14)15-6-9-27-23(22(15)28-20)7-10-29(11-8-23)13-17-19(25)4-3-18(24)21(17)26/h2-5,12,27-28H,6-11,13H2,1H3 |
| InChIKey | AAUGJQJODHJQDG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|