C17H23NO7 — CID 162670915
(4S)-1-benzyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrrolidin-2-one (PubChem CID 162670915) has the molecular formula C17H23NO7 and a molecular weight of 353.37 g/mol. Its IUPAC name is (4S)-1-benzyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrrolidin-2-one.
| Compound Name | (4S)-1-benzyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrrolidin-2-one |
|---|---|
| PubChem CID | 162670915 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (4S)-1-benzyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrrolidin-2-one |
| SMILES | O=C1C[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C17H23NO7/c19-9-12-14(21)15(22)16(23)17(25-12)24-11-6-13(20)18(8-11)7-10-4-2-1-3-5-10/h1-5,11-12,14-17,19,21-23H,6-9H2/t11-,12+,14+,15-,16+,17-/m0/s1 |
| InChIKey | BGJBGPSKRQEBJG-BKBBYTFDSA-N |
| XLogP | -1.40 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |