About 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine
8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine (PubChem CID 162671038) has the molecular formula C20H26N4O
and a molecular weight of 338.46 g/mol. Its IUPAC name is 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine.
Molecular Properties
| Compound Name | 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine |
| PubChem CID | 162671038 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine |
| SMILES | CC1(C)Cc2cc(OC3CCCNCC3)ccc2-c2ncnc(N)c21 |
| InChI | InChI=1S/C20H26N4O/c1-20(2)11-13-10-15(25-14-4-3-8-22-9-7-14)5-6-16(13)18-17(20)19(21)24-12-23-18/h5-6,10,12,14,22H,3-4,7-9,11H2,1-2H3,(H2,21,23,24) |
| InChIKey | WUVIWPIIVCUQKY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine?
The IUPAC name of 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine (CID 162671038) is 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine.
What is the SMILES notation for 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine?
The canonical SMILES for 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine is CC1(C)Cc2cc(OC3CCCNCC3)ccc2-c2ncnc(N)c21.
What is the InChIKey of 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine?
The InChIKey is WUVIWPIIVCUQKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O/c1-20(2)11-13-10-15(25-14-4-3-8-22-9-7-14)5-6-16(13)18-17(20)19(21)24-12-23-18/h5-6,10,12,14,22H,3-4,7-9,11H2,1-2H3,(H2,21,23,24).
What are the key properties of 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine?
8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine has a molecular weight of 338.46 g/mol, XLogP of 3.08, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(azepan-4-yloxy)-5,5-dimethyl-6H-benzo[h]quinazolin-4-amine is sourced from PubChem (CID 162671038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).