About 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine
1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine (PubChem CID 162671115) has the molecular formula C14H19ClN2O
and a molecular weight of 266.77 g/mol. Its IUPAC name is 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine |
| PubChem CID | 162671115 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine |
| SMILES | CN1CCN(CC2Cc3cc(Cl)ccc3O2)CC1 |
| InChI | InChI=1S/C14H19ClN2O/c1-16-4-6-17(7-5-16)10-13-9-11-8-12(15)2-3-14(11)18-13/h2-3,8,13H,4-7,9-10H2,1H3 |
| InChIKey | RNUOFCMNVAUGMR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine?
The IUPAC name of 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine (CID 162671115) is 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine.
What is the SMILES notation for 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine?
The canonical SMILES for 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine is CN1CCN(CC2Cc3cc(Cl)ccc3O2)CC1.
What is the InChIKey of 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine?
The InChIKey is RNUOFCMNVAUGMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN2O/c1-16-4-6-17(7-5-16)10-13-9-11-8-12(15)2-3-14(11)18-13/h2-3,8,13H,4-7,9-10H2,1H3.
What are the key properties of 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine?
1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine has a molecular weight of 266.77 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpiperazine is sourced from PubChem (CID 162671115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).