C20H32O2 — CID 162671195
(4aS,8aS)-3,4a,8,8-tetramethyl-4-[2-(oxolan-3-yl)ethyl]-5,6,7,8a-tetrahydro-1H-naphthalen-2-one (PubChem CID 162671195) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (4aS,8aS)-3,4a,8,8-tetramethyl-4-[2-(oxolan-3-yl)ethyl]-5,6,7,8a-tetrahydro-1H-naphthalen-2-one.
| Compound Name | (4aS,8aS)-3,4a,8,8-tetramethyl-4-[2-(oxolan-3-yl)ethyl]-5,6,7,8a-tetrahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 162671195 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (4aS,8aS)-3,4a,8,8-tetramethyl-4-[2-(oxolan-3-yl)ethyl]-5,6,7,8a-tetrahydro-1H-naphthalen-2-one |
| SMILES | CC1=C(CCC2CCOC2)[C@@]2(C)CCCC(C)(C)[C@@H]2CC1=O |
| InChI | InChI=1S/C20H32O2/c1-14-16(7-6-15-8-11-22-13-15)20(4)10-5-9-19(2,3)18(20)12-17(14)21/h15,18H,5-13H2,1-4H3/t15?,18-,20+/m0/s1 |
| InChIKey | HSJSFCRCGGARIK-RUTXASTPSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |