About N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine
N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine (PubChem CID 162671258) has the molecular formula C21H27N
and a molecular weight of 293.45 g/mol. Its IUPAC name is N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine.
Molecular Properties
| Compound Name | N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine |
| PubChem CID | 162671258 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine |
| SMILES | c1ccc(CNCC[C@H]2CCC[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C21H27N/c1-3-8-19(9-4-1)17-22-15-14-18-10-7-13-21(16-18)20-11-5-2-6-12-20/h1-6,8-9,11-12,18,21-22H,7,10,13-17H2/t18-,21+/m1/s1 |
| InChIKey | SSLAKSDPAPMJKU-NQIIRXRSSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine?
The IUPAC name of N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine (CID 162671258) is N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine.
What is the SMILES notation for N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine?
The canonical SMILES for N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine is c1ccc(CNCC[C@H]2CCC[C@H](c3ccccc3)C2)cc1.
What is the InChIKey of N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine?
The InChIKey is SSLAKSDPAPMJKU-NQIIRXRSSA-N. The full InChI is InChI=1S/C21H27N/c1-3-8-19(9-4-1)17-22-15-14-18-10-7-13-21(16-18)20-11-5-2-6-12-20/h1-6,8-9,11-12,18,21-22H,7,10,13-17H2/t18-,21+/m1/s1.
What are the key properties of N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine?
N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine has a molecular weight of 293.45 g/mol, XLogP of 5.14, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[(1S,3S)-3-phenylcyclohexyl]ethanamine is sourced from PubChem (CID 162671258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).