C22H18N4O2S — CID 162671317
methyl 4-[1-(4-cyanonaphthalen-1-yl)imidazo[4,5-b]pyridin-2-yl]sulfanylbutanoate (PubChem CID 162671317) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is methyl 4-[1-(4-cyanonaphthalen-1-yl)imidazo[4,5-b]pyridin-2-yl]sulfanylbutanoate.
| Compound Name | methyl 4-[1-(4-cyanonaphthalen-1-yl)imidazo[4,5-b]pyridin-2-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 162671317 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | methyl 4-[1-(4-cyanonaphthalen-1-yl)imidazo[4,5-b]pyridin-2-yl]sulfanylbutanoate |
| SMILES | COC(=O)CCCSc1nc2ncccc2n1-c1ccc(C#N)c2ccccc12 |
| InChI | InChI=1S/C22H18N4O2S/c1-28-20(27)9-5-13-29-22-25-21-19(8-4-12-24-21)26(22)18-11-10-15(14-23)16-6-2-3-7-17(16)18/h2-4,6-8,10-12H,5,9,13H2,1H3 |
| InChIKey | BNJQONOOMXULGS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|