About 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one
10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one (PubChem CID 162671341) has the molecular formula C14H7ClO4
and a molecular weight of 274.66 g/mol. Its IUPAC name is 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one.
Molecular Properties
| Compound Name | 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one |
| PubChem CID | 162671341 |
| Molecular Formula | C14H7ClO4 |
| Molecular Weight | 274.66 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one |
| SMILES | O=c1oc2ccc3c(c2c2cc(Cl)ccc12)OCO3 |
| InChI | InChI=1S/C14H7ClO4/c15-7-1-2-8-9(5-7)12-10(19-14(8)16)3-4-11-13(12)18-6-17-11/h1-5H,6H2 |
| InChIKey | ITYDJKITADPKCK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.66 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one?
The IUPAC name of 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one (CID 162671341) is 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one.
What is the SMILES notation for 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one?
The canonical SMILES for 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one is O=c1oc2ccc3c(c2c2cc(Cl)ccc12)OCO3.
What is the InChIKey of 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one?
The InChIKey is ITYDJKITADPKCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7ClO4/c15-7-1-2-8-9(5-7)12-10(19-14(8)16)3-4-11-13(12)18-6-17-11/h1-5H,6H2.
What are the key properties of 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one?
10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one has a molecular weight of 274.66 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-chloro-[1,3]benzodioxolo[6,7-c]isochromen-7-one is sourced from PubChem (CID 162671341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).