C22H22N6O2S — CID 162671342
N-[2-(dimethylamino)-5-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]furan-2-carboxamide (PubChem CID 162671342) has the molecular formula C22H22N6O2S and a molecular weight of 434.53 g/mol. Its IUPAC name is N-[2-(dimethylamino)-5-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]furan-2-carboxamide.
| Compound Name | N-[2-(dimethylamino)-5-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 162671342 |
| Molecular Formula | C22H22N6O2S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-[2-(dimethylamino)-5-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]furan-2-carboxamide |
| SMILES | CN(C)c1ccc(Nc2ncnc3sc4c(c23)CCNC4)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C22H22N6O2S/c1-28(2)16-6-5-13(10-15(16)27-21(29)17-4-3-9-30-17)26-20-19-14-7-8-23-11-18(14)31-22(19)25-12-24-20/h3-6,9-10,12,23H,7-8,11H2,1-2H3,(H,27,29)(H,24,25,26) |
| InChIKey | LZBYCPKHCYUSDB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|