C24H32O3 — CID 162671375
(E)-4-[(1R,4aS,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-phenylbut-2-en-1-one (PubChem CID 162671375) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is (E)-4-[(1R,4aS,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-phenylbut-2-en-1-one.
| Compound Name | (E)-4-[(1R,4aS,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 162671375 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (E)-4-[(1R,4aS,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-phenylbut-2-en-1-one |
| SMILES | C=C1CC[C@@H]2[C@](C)(CO)[C@H](O)CC[C@@]2(C)[C@@H]1C/C=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H32O3/c1-17-12-13-21-23(2,15-14-22(27)24(21,3)16-25)19(17)10-7-11-20(26)18-8-5-4-6-9-18/h4-9,11,19,21-22,25,27H,1,10,12-16H2,2-3H3/b11-7+/t19-,21+,22-,23+,24+/m1/s1 |
| InChIKey | QUKRKDSKIXCBHB-SQAKROMBSA-N |
| XLogP | 4.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|