C27H43NO — CID 162671404
(9Z,12Z)-N-[1-(2-methylphenyl)ethyl]octadeca-9,12-dienamide (PubChem CID 162671404) has the molecular formula C27H43NO and a molecular weight of 397.65 g/mol. Its IUPAC name is (9Z,12Z)-N-[1-(2-methylphenyl)ethyl]octadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-[1-(2-methylphenyl)ethyl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 162671404 |
| Molecular Formula | C27H43NO |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 397.33 |
| IUPAC Name | (9Z,12Z)-N-[1-(2-methylphenyl)ethyl]octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NC(C)c1ccccc1C |
| InChI | InChI=1S/C27H43NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-27(29)28-25(3)26-22-20-19-21-24(26)2/h8-9,11-12,19-22,25H,4-7,10,13-18,23H2,1-3H3,(H,28,29)/b9-8-,12-11- |
| InChIKey | GUNCGATWHCTDJD-MURFETPASA-N |
| XLogP | 7.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|