C21H21F3N4O3 — CID 162671563
1-[[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]-3-(1-oxo-2H-isoquinolin-5-yl)urea (PubChem CID 162671563) has the molecular formula C21H21F3N4O3 and a molecular weight of 434.42 g/mol. Its IUPAC name is 1-[[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]-3-(1-oxo-2H-isoquinolin-5-yl)urea.
| Compound Name | 1-[[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]-3-(1-oxo-2H-isoquinolin-5-yl)urea |
|---|---|
| PubChem CID | 162671563 |
| Molecular Formula | C21H21F3N4O3 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 1-[[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]-3-(1-oxo-2H-isoquinolin-5-yl)urea |
| SMILES | CCCCOc1nc(C(F)(F)F)ccc1CNC(=O)Nc1cccc2c(=O)[nH]ccc12 |
| InChI | InChI=1S/C21H21F3N4O3/c1-2-3-11-31-19-13(7-8-17(28-19)21(22,23)24)12-26-20(30)27-16-6-4-5-15-14(16)9-10-25-18(15)29/h4-10H,2-3,11-12H2,1H3,(H,25,29)(H2,26,27,30) |
| InChIKey | LWNZEOFFGBIQIK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|