C19H17FN2O4S — CID 162671581
ethyl 5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrrole-3-carboxylate (PubChem CID 162671581) has the molecular formula C19H17FN2O4S and a molecular weight of 388.42 g/mol. Its IUPAC name is ethyl 5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrrole-3-carboxylate.
| Compound Name | ethyl 5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 162671581 |
| Molecular Formula | C19H17FN2O4S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | ethyl 5-(4-fluorophenyl)-1-(4-sulfamoylphenyl)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(F)cc2)n(-c2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C19H17FN2O4S/c1-2-26-19(23)14-11-18(13-3-5-15(20)6-4-13)22(12-14)16-7-9-17(10-8-16)27(21,24)25/h3-12H,2H2,1H3,(H2,21,24,25) |
| InChIKey | JQCQWHVHMJNYAB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |