About 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline
3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline (PubChem CID 162671607) has the molecular formula C29H30N2O3
and a molecular weight of 454.57 g/mol. Its IUPAC name is 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline.
Molecular Properties
| Compound Name | 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline |
| PubChem CID | 162671607 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline |
| SMILES | COc1cc(Oc2cccc(Nc3ccccc3)c2)cc(OC)c1CN[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C29H30N2O3/c1-21(22-11-6-4-7-12-22)30-20-27-28(32-2)18-26(19-29(27)33-3)34-25-16-10-15-24(17-25)31-23-13-8-5-9-14-23/h4-19,21,30-31H,20H2,1-3H3/t21-/m1/s1 |
| InChIKey | MTDCARHADBYKQC-OAQYLSRUSA-N |
| XLogP | 7.09 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline?
The IUPAC name of 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline (CID 162671607) is 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline.
What is the SMILES notation for 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline?
The canonical SMILES for 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline is COc1cc(Oc2cccc(Nc3ccccc3)c2)cc(OC)c1CN[C@H](C)c1ccccc1.
What is the InChIKey of 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline?
The InChIKey is MTDCARHADBYKQC-OAQYLSRUSA-N. The full InChI is InChI=1S/C29H30N2O3/c1-21(22-11-6-4-7-12-22)30-20-27-28(32-2)18-26(19-29(27)33-3)34-25-16-10-15-24(17-25)31-23-13-8-5-9-14-23/h4-19,21,30-31H,20H2,1-3H3/t21-/m1/s1.
What are the key properties of 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline?
3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline has a molecular weight of 454.57 g/mol, XLogP of 7.09, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dimethoxy-4-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]-N-phenylaniline is sourced from PubChem (CID 162671607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).